C17H17Cl2NS — CID 142014615
5-(3,4-dichlorophenyl)-8-(methylamino)-5,6,7,8-tetrahydronaphthalene-2-thiol (PubChem CID 142014615) has the molecular formula C17H17Cl2NS and a molecular weight of 338.30 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-8-(methylamino)-5,6,7,8-tetrahydronaphthalene-2-thiol.
| Compound Name | 5-(3,4-dichlorophenyl)-8-(methylamino)-5,6,7,8-tetrahydronaphthalene-2-thiol |
|---|---|
| PubChem CID | 142014615 |
| Molecular Formula | C17H17Cl2NS |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-8-(methylamino)-5,6,7,8-tetrahydronaphthalene-2-thiol |
| SMILES | CNC1CCC(c2ccc(Cl)c(Cl)c2)c2ccc(S)cc21 |
| InChI | InChI=1S/C17H17Cl2NS/c1-20-17-7-5-12(10-2-6-15(18)16(19)8-10)13-4-3-11(21)9-14(13)17/h2-4,6,8-9,12,17,20-21H,5,7H2,1H3 |
| InChIKey | LCSJMQRUUHKMOP-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|