C24H22Cl2N2O — CID 44609533
N-[(5S,8S)-5-(3,4-dichlorophenyl)-8-(methylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]benzamide (PubChem CID 44609533) has the molecular formula C24H22Cl2N2O and a molecular weight of 425.36 g/mol. Its IUPAC name is N-[(5S,8S)-5-(3,4-dichlorophenyl)-8-(methylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]benzamide.
| Compound Name | N-[(5S,8S)-5-(3,4-dichlorophenyl)-8-(methylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]benzamide |
|---|---|
| PubChem CID | 44609533 |
| Molecular Formula | C24H22Cl2N2O |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | N-[(5S,8S)-5-(3,4-dichlorophenyl)-8-(methylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]benzamide |
| SMILES | CN[C@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccc(NC(=O)c3ccccc3)cc21 |
| InChI | InChI=1S/C24H22Cl2N2O/c1-27-23-12-10-18(16-7-11-21(25)22(26)13-16)19-9-8-17(14-20(19)23)28-24(29)15-5-3-2-4-6-15/h2-9,11,13-14,18,23,27H,10,12H2,1H3,(H,28,29)/t18-,23-/m0/s1 |
| InChIKey | UFXXVKYEYXQPGW-MBSDFSHPSA-N |
| XLogP | 6.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |