C29H30Cl2N4O2 — CID 174797164
N'-benzyl-5-methyl-1,2-oxazole-3-carbohydrazide;(1S,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 174797164) has the molecular formula C29H30Cl2N4O2 and a molecular weight of 537.49 g/mol. Its IUPAC name is N'-benzyl-5-methyl-1,2-oxazole-3-carbohydrazide;(1S,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | N'-benzyl-5-methyl-1,2-oxazole-3-carbohydrazide;(1S,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 174797164 |
| Molecular Formula | C29H30Cl2N4O2 |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | N'-benzyl-5-methyl-1,2-oxazole-3-carbohydrazide;(1S,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CN[C@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccccc21.Cc1cc(C(=O)NNCc2ccccc2)no1 |
| InChI | InChI=1S/C17H17Cl2N.C12H13N3O2/c1-20-17-9-7-12(13-4-2-3-5-14(13)17)11-6-8-15(18)16(19)10-11;1-9-7-11(15-17-9)12(16)14-13-8-10-5-3-2-4-6-10/h2-6,8,10,12,17,20H,7,9H2,1H3;2-7,13H,8H2,1H3,(H,14,16)/t12-,17-;/m0./s1 |
| InChIKey | LMBXZNTZVVOPIV-XHXSRVRCSA-N |
| XLogP | 6.60 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|