C20H24Cl2N4 — CID 142014622
(1S,4S)-7-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 142014622) has the molecular formula C20H24Cl2N4 and a molecular weight of 391.35 g/mol. Its IUPAC name is (1S,4S)-7-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1S,4S)-7-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 142014622 |
| Molecular Formula | C20H24Cl2N4 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | (1S,4S)-7-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CN[C@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccc(CN(N)/C=C\N)cc21 |
| InChI | InChI=1S/C20H24Cl2N4/c1-25-20-7-5-15(14-3-6-18(21)19(22)11-14)16-4-2-13(10-17(16)20)12-26(24)9-8-23/h2-4,6,8-11,15,20,25H,5,7,12,23-24H2,1H3/b9-8-/t15-,20-/m0/s1 |
| InChIKey | KKPQTPXRXXLSEC-OBVXAHTISA-N |
| XLogP | 4.29 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|