C19H25IN4 — CID 120605953
2-[[1-(3,4-dimethylphenyl)cyclobutyl]methyl]-1-pyridin-2-ylguanidine;hydroiodide (PubChem CID 120605953) has the molecular formula C19H25IN4 and a molecular weight of 436.34 g/mol. Its IUPAC name is 2-[[1-(3,4-dimethylphenyl)cyclobutyl]methyl]-1-pyridin-2-ylguanidine;hydroiodide.
| Compound Name | 2-[[1-(3,4-dimethylphenyl)cyclobutyl]methyl]-1-pyridin-2-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 120605953 |
| Molecular Formula | C19H25IN4 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 2-[[1-(3,4-dimethylphenyl)cyclobutyl]methyl]-1-pyridin-2-ylguanidine;hydroiodide |
| SMILES | Cc1ccc(C2(C/N=C(\N)Nc3ccccn3)CCC2)cc1C.I |
| InChI | InChI=1S/C19H24N4.HI/c1-14-7-8-16(12-15(14)2)19(9-5-10-19)13-22-18(20)23-17-6-3-4-11-21-17;/h3-4,6-8,11-12H,5,9-10,13H2,1-2H3,(H3,20,21,22,23);1H |
| InChIKey | NWQXGMYKPBILKX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|