C23H32N4O2 — CID 111580915
2-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]-1-(2-pyridin-2-ylethyl)guanidine (PubChem CID 111580915) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 2-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]-1-(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 2-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]-1-(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111580915 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 2-[[1-(3,4-dimethoxyphenyl)cyclohexyl]methyl]-1-(2-pyridin-2-ylethyl)guanidine |
| SMILES | COc1ccc(C2(C/N=C(\N)NCCc3ccccn3)CCCCC2)cc1OC |
| InChI | InChI=1S/C23H32N4O2/c1-28-20-10-9-18(16-21(20)29-2)23(12-5-3-6-13-23)17-27-22(24)26-15-11-19-8-4-7-14-25-19/h4,7-10,14,16H,3,5-6,11-13,15,17H2,1-2H3,(H3,24,26,27) |
| InChIKey | ZGIREPDMRZBIFR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|