C21H27BrIN3O — CID 111097266
2-[[4-(4-bromophenyl)oxan-4-yl]methyl]-1-(3,4-dimethylphenyl)guanidine;hydroiodide (PubChem CID 111097266) has the molecular formula C21H27BrIN3O and a molecular weight of 544.28 g/mol. Its IUPAC name is 2-[[4-(4-bromophenyl)oxan-4-yl]methyl]-1-(3,4-dimethylphenyl)guanidine;hydroiodide.
| Compound Name | 2-[[4-(4-bromophenyl)oxan-4-yl]methyl]-1-(3,4-dimethylphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111097266 |
| Molecular Formula | C21H27BrIN3O |
| Molecular Weight | 544.28 g/mol |
| Exact Mass | 543.04 |
| IUPAC Name | 2-[[4-(4-bromophenyl)oxan-4-yl]methyl]-1-(3,4-dimethylphenyl)guanidine;hydroiodide |
| SMILES | Cc1ccc(N/C(N)=N/CC2(c3ccc(Br)cc3)CCOCC2)cc1C.I |
| InChI | InChI=1S/C21H26BrN3O.HI/c1-15-3-8-19(13-16(15)2)25-20(23)24-14-21(9-11-26-12-10-21)17-4-6-18(22)7-5-17;/h3-8,13H,9-12,14H2,1-2H3,(H3,23,24,25);1H |
| InChIKey | JVXAALZGEDRRGK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.28 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|