C17H24BrN3O — CID 111097301
2-[[4-(4-bromophenyl)oxan-4-yl]methyl]-1-(2-methylprop-2-enyl)guanidine (PubChem CID 111097301) has the molecular formula C17H24BrN3O and a molecular weight of 366.30 g/mol. Its IUPAC name is 2-[[4-(4-bromophenyl)oxan-4-yl]methyl]-1-(2-methylprop-2-enyl)guanidine.
| Compound Name | 2-[[4-(4-bromophenyl)oxan-4-yl]methyl]-1-(2-methylprop-2-enyl)guanidine |
|---|---|
| PubChem CID | 111097301 |
| Molecular Formula | C17H24BrN3O |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 2-[[4-(4-bromophenyl)oxan-4-yl]methyl]-1-(2-methylprop-2-enyl)guanidine |
| SMILES | C=C(C)CN/C(N)=N/CC1(c2ccc(Br)cc2)CCOCC1 |
| InChI | InChI=1S/C17H24BrN3O/c1-13(2)11-20-16(19)21-12-17(7-9-22-10-8-17)14-3-5-15(18)6-4-14/h3-6H,1,7-12H2,2H3,(H3,19,20,21) |
| InChIKey | KZPICWKSAAEBGV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|