C22H29N3O — CID 111081015
1-(3,5-dimethylphenyl)-2-[[4-(2-methylphenyl)oxan-4-yl]methyl]guanidine (PubChem CID 111081015) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-[[4-(2-methylphenyl)oxan-4-yl]methyl]guanidine.
| Compound Name | 1-(3,5-dimethylphenyl)-2-[[4-(2-methylphenyl)oxan-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111081015 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-[[4-(2-methylphenyl)oxan-4-yl]methyl]guanidine |
| SMILES | Cc1cc(C)cc(N/C(N)=N/CC2(c3ccccc3C)CCOCC2)c1 |
| InChI | InChI=1S/C22H29N3O/c1-16-12-17(2)14-19(13-16)25-21(23)24-15-22(8-10-26-11-9-22)20-7-5-4-6-18(20)3/h4-7,12-14H,8-11,15H2,1-3H3,(H3,23,24,25) |
| InChIKey | NMMNMXBOPGPQAI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|