C18H27F3IN3 — CID 111083320
1,1-diethyl-2-[[1-[3-(trifluoromethyl)phenyl]cyclopentyl]methyl]guanidine;hydroiodide (PubChem CID 111083320) has the molecular formula C18H27F3IN3 and a molecular weight of 469.33 g/mol. Its IUPAC name is 1,1-diethyl-2-[[1-[3-(trifluoromethyl)phenyl]cyclopentyl]methyl]guanidine;hydroiodide.
| Compound Name | 1,1-diethyl-2-[[1-[3-(trifluoromethyl)phenyl]cyclopentyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111083320 |
| Molecular Formula | C18H27F3IN3 |
| Molecular Weight | 469.33 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 1,1-diethyl-2-[[1-[3-(trifluoromethyl)phenyl]cyclopentyl]methyl]guanidine;hydroiodide |
| SMILES | CCN(CC)/C(N)=N/CC1(c2cccc(C(F)(F)F)c2)CCCC1.I |
| InChI | InChI=1S/C18H26F3N3.HI/c1-3-24(4-2)16(22)23-13-17(10-5-6-11-17)14-8-7-9-15(12-14)18(19,20)21;/h7-9,12H,3-6,10-11,13H2,1-2H3,(H2,22,23);1H |
| InChIKey | OSEZSYWCFNQLLN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.33 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|