C22H29FIN3O — CID 111080972
2-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-1-(3-propan-2-ylphenyl)guanidine;hydroiodide (PubChem CID 111080972) has the molecular formula C22H29FIN3O and a molecular weight of 497.40 g/mol. Its IUPAC name is 2-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-1-(3-propan-2-ylphenyl)guanidine;hydroiodide.
| Compound Name | 2-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-1-(3-propan-2-ylphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111080972 |
| Molecular Formula | C22H29FIN3O |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 2-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-1-(3-propan-2-ylphenyl)guanidine;hydroiodide |
| SMILES | CC(C)c1cccc(N/C(N)=N/CC2(c3cccc(F)c3)CCOCC2)c1.I |
| InChI | InChI=1S/C22H28FN3O.HI/c1-16(2)17-5-3-8-20(13-17)26-21(24)25-15-22(9-11-27-12-10-22)18-6-4-7-19(23)14-18;/h3-8,13-14,16H,9-12,15H2,1-2H3,(H3,24,25,26);1H |
| InChIKey | TVSFQBMZATXUAU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|