C18H27FIN3O2 — CID 110918231
2-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-1-(oxolan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110918231) has the molecular formula C18H27FIN3O2 and a molecular weight of 463.34 g/mol. Its IUPAC name is 2-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-1-(oxolan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-1-(oxolan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110918231 |
| Molecular Formula | C18H27FIN3O2 |
| Molecular Weight | 463.34 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 2-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-1-(oxolan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CC1(c2cccc(F)c2)CCOCC1)NCC1CCCO1 |
| InChI | InChI=1S/C18H26FN3O2.HI/c19-15-4-1-3-14(11-15)18(6-9-23-10-7-18)13-22-17(20)21-12-16-5-2-8-24-16;/h1,3-4,11,16H,2,5-10,12-13H2,(H3,20,21,22);1H |
| InChIKey | SLBQEVJMLWOALW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|