C24H35FN4O3 — CID 111302401
N-ethyl-N'-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide (PubChem CID 111302401) has the molecular formula C24H35FN4O3 and a molecular weight of 446.57 g/mol. Its IUPAC name is N-ethyl-N'-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111302401 |
| Molecular Formula | C24H35FN4O3 |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | N-ethyl-N'-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1(c2cccc(F)c2)CCOCC1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C24H35FN4O3/c1-2-26-23(29-12-10-28(11-13-29)22(30)21-7-4-14-32-21)27-18-24(8-15-31-16-9-24)19-5-3-6-20(25)17-19/h3,5-6,17,21H,2,4,7-16,18H2,1H3,(H,26,27) |
| InChIKey | LZCHMPZQNUXQRD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|