C21H33FIN3O — CID 111209789
N-ethyl-N'-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-4-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111209789) has the molecular formula C21H33FIN3O and a molecular weight of 489.42 g/mol. Its IUPAC name is N-ethyl-N'-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-4-methylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-4-methylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111209789 |
| Molecular Formula | C21H33FIN3O |
| Molecular Weight | 489.42 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | N-ethyl-N'-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-4-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1(c2ccc(F)cc2)CCOCC1)N1CCC(C)CC1.I |
| InChI | InChI=1S/C21H32FN3O.HI/c1-3-23-20(25-12-8-17(2)9-13-25)24-16-21(10-14-26-15-11-21)18-4-6-19(22)7-5-18;/h4-7,17H,3,8-16H2,1-2H3,(H,23,24);1H |
| InChIKey | ALDAENRPAYHMCR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|