C22H34IN3O3 — CID 111144227
N'-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-N-ethyl-3-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111144227) has the molecular formula C22H34IN3O3 and a molecular weight of 515.44 g/mol. Its IUPAC name is N'-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-N-ethyl-3-methylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-N-ethyl-3-methylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111144227 |
| Molecular Formula | C22H34IN3O3 |
| Molecular Weight | 515.44 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | N'-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-N-ethyl-3-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1(c2ccc3c(c2)OCO3)CCOCC1)N1CCCC(C)C1.I |
| InChI | InChI=1S/C22H33N3O3.HI/c1-3-23-21(25-10-4-5-17(2)14-25)24-15-22(8-11-26-12-9-22)18-6-7-19-20(13-18)28-16-27-19;/h6-7,13,17H,3-5,8-12,14-16H2,1-2H3,(H,23,24);1H |
| InChIKey | NCNXDEZLBFNDMI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|