C24H35N3O3 — CID 111733751
N'-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-N-ethyl-2-azaspiro[4.4]nonane-2-carboximidamide (PubChem CID 111733751) has the molecular formula C24H35N3O3 and a molecular weight of 413.56 g/mol. Its IUPAC name is N'-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-N-ethyl-2-azaspiro[4.4]nonane-2-carboximidamide.
| Compound Name | N'-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-N-ethyl-2-azaspiro[4.4]nonane-2-carboximidamide |
|---|---|
| PubChem CID | 111733751 |
| Molecular Formula | C24H35N3O3 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | N'-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-N-ethyl-2-azaspiro[4.4]nonane-2-carboximidamide |
| SMILES | CCN/C(=N\CC1(c2ccc3c(c2)OCO3)CCOCC1)N1CCC2(CCCC2)C1 |
| InChI | InChI=1S/C24H35N3O3/c1-2-25-22(27-12-9-23(17-27)7-3-4-8-23)26-16-24(10-13-28-14-11-24)19-5-6-20-21(15-19)30-18-29-20/h5-6,15H,2-4,7-14,16-18H2,1H3,(H,25,26) |
| InChIKey | RABCPIRUHOSBDB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|