C24H38N4O3 — CID 111017133
2-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine (PubChem CID 111017133) has the molecular formula C24H38N4O3 and a molecular weight of 430.59 g/mol. Its IUPAC name is 2-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine.
| Compound Name | 2-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 111017133 |
| Molecular Formula | C24H38N4O3 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | 2-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine |
| SMILES | CCCN1CCC(N/C(=N/CC2(c3ccc4c(c3)OCO4)CCOCC2)NCC)CC1 |
| InChI | InChI=1S/C24H38N4O3/c1-3-11-28-12-7-20(8-13-28)27-23(25-4-2)26-17-24(9-14-29-15-10-24)19-5-6-21-22(16-19)31-18-30-21/h5-6,16,20H,3-4,7-15,17-18H2,1-2H3,(H2,25,26,27) |
| InChIKey | AWMFCXVHPBCYBK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|