C23H36N4O5 — CID 111885183
tert-butyl N-[2-[[N'-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]carbamate (PubChem CID 111885183) has the molecular formula C23H36N4O5 and a molecular weight of 448.56 g/mol. Its IUPAC name is tert-butyl N-[2-[[N'-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[N'-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111885183 |
| Molecular Formula | C23H36N4O5 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | tert-butyl N-[2-[[N'-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]carbamate |
| SMILES | CCN/C(=N\CC1(c2ccc3c(c2)OCO3)CCOCC1)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H36N4O5/c1-5-24-20(25-10-11-26-21(28)32-22(2,3)4)27-15-23(8-12-29-13-9-23)17-6-7-18-19(14-17)31-16-30-18/h6-7,14H,5,8-13,15-16H2,1-4H3,(H,26,28)(H2,24,25,27) |
| InChIKey | FHIMIMLDNHWBEE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|