C23H37FN4O3 — CID 111886507
tert-butyl N-[3-[[N-ethyl-N'-[[4-(3-fluorophenyl)oxan-4-yl]methyl]carbamimidoyl]amino]propyl]carbamate (PubChem CID 111886507) has the molecular formula C23H37FN4O3 and a molecular weight of 436.57 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-ethyl-N'-[[4-(3-fluorophenyl)oxan-4-yl]methyl]carbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N-ethyl-N'-[[4-(3-fluorophenyl)oxan-4-yl]methyl]carbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111886507 |
| Molecular Formula | C23H37FN4O3 |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | tert-butyl N-[3-[[N-ethyl-N'-[[4-(3-fluorophenyl)oxan-4-yl]methyl]carbamimidoyl]amino]propyl]carbamate |
| SMILES | CCN/C(=N\CC1(c2cccc(F)c2)CCOCC1)NCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H37FN4O3/c1-5-25-20(26-12-7-13-27-21(29)31-22(2,3)4)28-17-23(10-14-30-15-11-23)18-8-6-9-19(24)16-18/h6,8-9,16H,5,7,10-15,17H2,1-4H3,(H,27,29)(H2,25,26,28) |
| InChIKey | XPRNPGKEZIKCIG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|