C23H38FIN4O3 — CID 111886750
tert-butyl N-[3-[[N-ethyl-N'-[[4-(4-fluorophenyl)oxan-4-yl]methyl]carbamimidoyl]amino]propyl]carbamate;hydroiodide (PubChem CID 111886750) has the molecular formula C23H38FIN4O3 and a molecular weight of 564.48 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-ethyl-N'-[[4-(4-fluorophenyl)oxan-4-yl]methyl]carbamimidoyl]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[N-ethyl-N'-[[4-(4-fluorophenyl)oxan-4-yl]methyl]carbamimidoyl]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111886750 |
| Molecular Formula | C23H38FIN4O3 |
| Molecular Weight | 564.48 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | tert-butyl N-[3-[[N-ethyl-N'-[[4-(4-fluorophenyl)oxan-4-yl]methyl]carbamimidoyl]amino]propyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CC1(c2ccc(F)cc2)CCOCC1)NCCCNC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C23H37FN4O3.HI/c1-5-25-20(26-13-6-14-27-21(29)31-22(2,3)4)28-17-23(11-15-30-16-12-23)18-7-9-19(24)10-8-18;/h7-10H,5-6,11-17H2,1-4H3,(H,27,29)(H2,25,26,28);1H |
| InChIKey | QGKIIGLVHKRODH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|