C24H41IN4O4 — CID 111885674
tert-butyl N-[2-[[N'-[[4-(4-ethoxyphenyl)oxan-4-yl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 111885674) has the molecular formula C24H41IN4O4 and a molecular weight of 576.52 g/mol. Its IUPAC name is tert-butyl N-[2-[[N'-[[4-(4-ethoxyphenyl)oxan-4-yl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N'-[[4-(4-ethoxyphenyl)oxan-4-yl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111885674 |
| Molecular Formula | C24H41IN4O4 |
| Molecular Weight | 576.52 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | tert-butyl N-[2-[[N'-[[4-(4-ethoxyphenyl)oxan-4-yl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CC1(c2ccc(OCC)cc2)CCOCC1)NCCNC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C24H40N4O4.HI/c1-6-25-21(26-14-15-27-22(29)32-23(3,4)5)28-18-24(12-16-30-17-13-24)19-8-10-20(11-9-19)31-7-2;/h8-11H,6-7,12-18H2,1-5H3,(H,27,29)(H2,25,26,28);1H |
| InChIKey | YVVVKKLWNYOZNA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|