C19H29FIN3O2 — CID 111639461
ethyl 4-[[N-ethyl-N'-[[1-(3-fluorophenyl)cyclopropyl]methyl]carbamimidoyl]amino]butanoate;hydroiodide (PubChem CID 111639461) has the molecular formula C19H29FIN3O2 and a molecular weight of 477.36 g/mol. Its IUPAC name is ethyl 4-[[N-ethyl-N'-[[1-(3-fluorophenyl)cyclopropyl]methyl]carbamimidoyl]amino]butanoate;hydroiodide.
| Compound Name | ethyl 4-[[N-ethyl-N'-[[1-(3-fluorophenyl)cyclopropyl]methyl]carbamimidoyl]amino]butanoate;hydroiodide |
|---|---|
| PubChem CID | 111639461 |
| Molecular Formula | C19H29FIN3O2 |
| Molecular Weight | 477.36 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | ethyl 4-[[N-ethyl-N'-[[1-(3-fluorophenyl)cyclopropyl]methyl]carbamimidoyl]amino]butanoate;hydroiodide |
| SMILES | CCN/C(=N\CC1(c2cccc(F)c2)CC1)NCCCC(=O)OCC.I |
| InChI | InChI=1S/C19H28FN3O2.HI/c1-3-21-18(22-12-6-9-17(24)25-4-2)23-14-19(10-11-19)15-7-5-8-16(20)13-15;/h5,7-8,13H,3-4,6,9-12,14H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | LZGJXNHIMJVNDA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|