C23H28F2N4O — CID 111638716
N-[2-[[N-ethyl-N'-[[1-(3-fluorophenyl)cyclopropyl]methyl]carbamimidoyl]amino]ethyl]-2-(4-fluorophenyl)acetamide (PubChem CID 111638716) has the molecular formula C23H28F2N4O and a molecular weight of 414.50 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[[1-(3-fluorophenyl)cyclopropyl]methyl]carbamimidoyl]amino]ethyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[2-[[N-ethyl-N'-[[1-(3-fluorophenyl)cyclopropyl]methyl]carbamimidoyl]amino]ethyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 111638716 |
| Molecular Formula | C23H28F2N4O |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[[1-(3-fluorophenyl)cyclopropyl]methyl]carbamimidoyl]amino]ethyl]-2-(4-fluorophenyl)acetamide |
| SMILES | CCN/C(=N\CC1(c2cccc(F)c2)CC1)NCCNC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C23H28F2N4O/c1-2-26-22(29-16-23(10-11-23)18-4-3-5-20(25)15-18)28-13-12-27-21(30)14-17-6-8-19(24)9-7-17/h3-9,15H,2,10-14,16H2,1H3,(H,27,30)(H2,26,28,29) |
| InChIKey | ABJPSLBDRUQUDB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|