C21H26FN3O2S — CID 111638250
1-[2-(benzenesulfonyl)ethyl]-3-ethyl-2-[[1-(3-fluorophenyl)cyclopropyl]methyl]guanidine (PubChem CID 111638250) has the molecular formula C21H26FN3O2S and a molecular weight of 403.52 g/mol. Its IUPAC name is 1-[2-(benzenesulfonyl)ethyl]-3-ethyl-2-[[1-(3-fluorophenyl)cyclopropyl]methyl]guanidine.
| Compound Name | 1-[2-(benzenesulfonyl)ethyl]-3-ethyl-2-[[1-(3-fluorophenyl)cyclopropyl]methyl]guanidine |
|---|---|
| PubChem CID | 111638250 |
| Molecular Formula | C21H26FN3O2S |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 1-[2-(benzenesulfonyl)ethyl]-3-ethyl-2-[[1-(3-fluorophenyl)cyclopropyl]methyl]guanidine |
| SMILES | CCN/C(=N\CC1(c2cccc(F)c2)CC1)NCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H26FN3O2S/c1-2-23-20(24-13-14-28(26,27)19-9-4-3-5-10-19)25-16-21(11-12-21)17-7-6-8-18(22)15-17/h3-10,15H,2,11-14,16H2,1H3,(H2,23,24,25) |
| InChIKey | DAGIELWVKCORMO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|