C21H27FN4O2S — CID 111639456
1-ethyl-2-[[1-(3-fluorophenyl)cyclopropyl]methyl]-3-[2-(4-sulfamoylphenyl)ethyl]guanidine (PubChem CID 111639456) has the molecular formula C21H27FN4O2S and a molecular weight of 418.54 g/mol. Its IUPAC name is 1-ethyl-2-[[1-(3-fluorophenyl)cyclopropyl]methyl]-3-[2-(4-sulfamoylphenyl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[[1-(3-fluorophenyl)cyclopropyl]methyl]-3-[2-(4-sulfamoylphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111639456 |
| Molecular Formula | C21H27FN4O2S |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 1-ethyl-2-[[1-(3-fluorophenyl)cyclopropyl]methyl]-3-[2-(4-sulfamoylphenyl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC1(c2cccc(F)c2)CC1)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C21H27FN4O2S/c1-2-24-20(25-13-10-16-6-8-19(9-7-16)29(23,27)28)26-15-21(11-12-21)17-4-3-5-18(22)14-17/h3-9,14H,2,10-13,15H2,1H3,(H2,23,27,28)(H2,24,25,26) |
| InChIKey | LQZRFQILDNXNPQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|