C24H39N3O4 — CID 111717940
2-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-1-(3-ethoxy-4-methylpentyl)-3-ethylguanidine (PubChem CID 111717940) has the molecular formula C24H39N3O4 and a molecular weight of 433.59 g/mol. Its IUPAC name is 2-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-1-(3-ethoxy-4-methylpentyl)-3-ethylguanidine.
| Compound Name | 2-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-1-(3-ethoxy-4-methylpentyl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111717940 |
| Molecular Formula | C24H39N3O4 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.29 |
| IUPAC Name | 2-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-1-(3-ethoxy-4-methylpentyl)-3-ethylguanidine |
| SMILES | CCN/C(=N\CC1(c2ccc3c(c2)OCO3)CCOCC1)NCCC(OCC)C(C)C |
| InChI | InChI=1S/C24H39N3O4/c1-5-25-23(26-12-9-20(18(3)4)29-6-2)27-16-24(10-13-28-14-11-24)19-7-8-21-22(15-19)31-17-30-21/h7-8,15,18,20H,5-6,9-14,16-17H2,1-4H3,(H2,25,26,27) |
| InChIKey | KUXQQEPCTWLSRU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|