C24H41N3O3 — CID 111717420
1-(3-ethoxy-4-methylpentyl)-3-ethyl-2-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]guanidine (PubChem CID 111717420) has the molecular formula C24H41N3O3 and a molecular weight of 419.61 g/mol. Its IUPAC name is 1-(3-ethoxy-4-methylpentyl)-3-ethyl-2-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]guanidine.
| Compound Name | 1-(3-ethoxy-4-methylpentyl)-3-ethyl-2-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111717420 |
| Molecular Formula | C24H41N3O3 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.31 |
| IUPAC Name | 1-(3-ethoxy-4-methylpentyl)-3-ethyl-2-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]guanidine |
| SMILES | CCN/C(=N\CC1(c2ccc(OC)cc2)CCOCC1)NCCC(OCC)C(C)C |
| InChI | InChI=1S/C24H41N3O3/c1-6-25-23(26-15-12-22(19(3)4)30-7-2)27-18-24(13-16-29-17-14-24)20-8-10-21(28-5)11-9-20/h8-11,19,22H,6-7,12-18H2,1-5H3,(H2,25,26,27) |
| InChIKey | FYZPENPWMVFCOZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|