C21H31N3O3 — CID 111551284
(3R)-N'-[[1-(1,3-benzodioxol-5-yl)cyclohexyl]methyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide (PubChem CID 111551284) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is (3R)-N'-[[1-(1,3-benzodioxol-5-yl)cyclohexyl]methyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide.
| Compound Name | (3R)-N'-[[1-(1,3-benzodioxol-5-yl)cyclohexyl]methyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111551284 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | (3R)-N'-[[1-(1,3-benzodioxol-5-yl)cyclohexyl]methyl]-N-ethyl-3-hydroxypyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1(c2ccc3c(c2)OCO3)CCCCC1)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C21H31N3O3/c1-2-22-20(24-11-8-17(25)13-24)23-14-21(9-4-3-5-10-21)16-6-7-18-19(12-16)27-15-26-18/h6-7,12,17,25H,2-5,8-11,13-15H2,1H3,(H,22,23)/t17-/m1/s1 |
| InChIKey | FPRVXYZZVQHLQK-QGZVFWFLSA-N |
| XLogP | 2.65 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|