C21H33N3O — CID 111212175
N-ethyl-4-methyl-N'-[(4-phenyloxan-4-yl)methyl]piperidine-1-carboximidamide (PubChem CID 111212175) has the molecular formula C21H33N3O and a molecular weight of 343.51 g/mol. Its IUPAC name is N-ethyl-4-methyl-N'-[(4-phenyloxan-4-yl)methyl]piperidine-1-carboximidamide.
| Compound Name | N-ethyl-4-methyl-N'-[(4-phenyloxan-4-yl)methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111212175 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | N-ethyl-4-methyl-N'-[(4-phenyloxan-4-yl)methyl]piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1(c2ccccc2)CCOCC1)N1CCC(C)CC1 |
| InChI | InChI=1S/C21H33N3O/c1-3-22-20(24-13-9-18(2)10-14-24)23-17-21(11-15-25-16-12-21)19-7-5-4-6-8-19/h4-8,18H,3,9-17H2,1-2H3,(H,22,23) |
| InChIKey | FORRWQLTSIYXQG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|