C21H32ClN3O2 — CID 111737913
N'-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-N-ethyl-3-(methoxymethyl)pyrrolidine-1-carboximidamide (PubChem CID 111737913) has the molecular formula C21H32ClN3O2 and a molecular weight of 393.96 g/mol. Its IUPAC name is N'-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-N-ethyl-3-(methoxymethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-N-ethyl-3-(methoxymethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111737913 |
| Molecular Formula | C21H32ClN3O2 |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | N'-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-N-ethyl-3-(methoxymethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1(c2cccc(Cl)c2)CCOCC1)N1CCC(COC)C1 |
| InChI | InChI=1S/C21H32ClN3O2/c1-3-23-20(25-10-7-17(14-25)15-26-2)24-16-21(8-11-27-12-9-21)18-5-4-6-19(22)13-18/h4-6,13,17H,3,7-12,14-16H2,1-2H3,(H,23,24) |
| InChIKey | VWWOPKLHIZFBMC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|