C23H36ClN3O2 — CID 111747881
N'-[[1-(4-chlorophenyl)cyclopentyl]methyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide (PubChem CID 111747881) has the molecular formula C23H36ClN3O2 and a molecular weight of 422.01 g/mol. Its IUPAC name is N'-[[1-(4-chlorophenyl)cyclopentyl]methyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N'-[[1-(4-chlorophenyl)cyclopentyl]methyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111747881 |
| Molecular Formula | C23H36ClN3O2 |
| Molecular Weight | 422.01 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | N'-[[1-(4-chlorophenyl)cyclopentyl]methyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1(c2ccc(Cl)cc2)CCCC1)N1CCC(COCCOC)C1 |
| InChI | InChI=1S/C23H36ClN3O2/c1-3-25-22(27-13-10-19(16-27)17-29-15-14-28-2)26-18-23(11-4-5-12-23)20-6-8-21(24)9-7-20/h6-9,19H,3-5,10-18H2,1-2H3,(H,25,26) |
| InChIKey | UDBWOAYIFGXQHL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.01 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|