C25H33N3O — CID 111723771
N-ethyl-3-phenyl-N'-[(4-phenyloxan-4-yl)methyl]pyrrolidine-1-carboximidamide (PubChem CID 111723771) has the molecular formula C25H33N3O and a molecular weight of 391.56 g/mol. Its IUPAC name is N-ethyl-3-phenyl-N'-[(4-phenyloxan-4-yl)methyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-3-phenyl-N'-[(4-phenyloxan-4-yl)methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111723771 |
| Molecular Formula | C25H33N3O |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | N-ethyl-3-phenyl-N'-[(4-phenyloxan-4-yl)methyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1(c2ccccc2)CCOCC1)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C25H33N3O/c1-2-26-24(28-16-13-22(19-28)21-9-5-3-6-10-21)27-20-25(14-17-29-18-15-25)23-11-7-4-8-12-23/h3-12,22H,2,13-20H2,1H3,(H,26,27) |
| InChIKey | UOWREDATMDOHSO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|