C22H33N3O2 — CID 111154846
ethyl 1-[N-ethyl-N'-[(1-phenylcyclobutyl)methyl]carbamimidoyl]piperidine-4-carboxylate (PubChem CID 111154846) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is ethyl 1-[N-ethyl-N'-[(1-phenylcyclobutyl)methyl]carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[N-ethyl-N'-[(1-phenylcyclobutyl)methyl]carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111154846 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | ethyl 1-[N-ethyl-N'-[(1-phenylcyclobutyl)methyl]carbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCN/C(=N\CC1(c2ccccc2)CCC1)N1CCC(C(=O)OCC)CC1 |
| InChI | InChI=1S/C22H33N3O2/c1-3-23-21(25-15-11-18(12-16-25)20(26)27-4-2)24-17-22(13-8-14-22)19-9-6-5-7-10-19/h5-7,9-10,18H,3-4,8,11-17H2,1-2H3,(H,23,24) |
| InChIKey | WIFAVUUPEPKERI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|