C23H34FN3O3 — CID 110993089
ethyl 1-[N-ethyl-N'-[[4-(4-fluorophenyl)oxan-4-yl]methyl]carbamimidoyl]piperidine-3-carboxylate (PubChem CID 110993089) has the molecular formula C23H34FN3O3 and a molecular weight of 419.54 g/mol. Its IUPAC name is ethyl 1-[N-ethyl-N'-[[4-(4-fluorophenyl)oxan-4-yl]methyl]carbamimidoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[N-ethyl-N'-[[4-(4-fluorophenyl)oxan-4-yl]methyl]carbamimidoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 110993089 |
| Molecular Formula | C23H34FN3O3 |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | ethyl 1-[N-ethyl-N'-[[4-(4-fluorophenyl)oxan-4-yl]methyl]carbamimidoyl]piperidine-3-carboxylate |
| SMILES | CCN/C(=N\CC1(c2ccc(F)cc2)CCOCC1)N1CCCC(C(=O)OCC)C1 |
| InChI | InChI=1S/C23H34FN3O3/c1-3-25-22(27-13-5-6-18(16-27)21(28)30-4-2)26-17-23(11-14-29-15-12-23)19-7-9-20(24)10-8-19/h7-10,18H,3-6,11-17H2,1-2H3,(H,25,26) |
| InChIKey | SDBLOANNZPOEIE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|