C19H35N5O2S — CID 119156864
N'-[[3-(dimethylamino)thiolan-3-yl]methyl]-N-ethyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide (PubChem CID 119156864) has the molecular formula C19H35N5O2S and a molecular weight of 397.59 g/mol. Its IUPAC name is N'-[[3-(dimethylamino)thiolan-3-yl]methyl]-N-ethyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide.
| Compound Name | N'-[[3-(dimethylamino)thiolan-3-yl]methyl]-N-ethyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119156864 |
| Molecular Formula | C19H35N5O2S |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | N'-[[3-(dimethylamino)thiolan-3-yl]methyl]-N-ethyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1(N(C)C)CCSC1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C19H35N5O2S/c1-4-20-18(21-14-19(22(2)3)7-13-27-15-19)24-10-8-23(9-11-24)17(25)16-6-5-12-26-16/h16H,4-15H2,1-3H3,(H,20,21) |
| InChIKey | SIWDSCHNFOSLIY-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|