C18H35N5OS — CID 119156894
N'-[[3-(dimethylamino)thiolan-3-yl]methyl]-N-ethyl-4-(2-methylpropanoyl)piperazine-1-carboximidamide (PubChem CID 119156894) has the molecular formula C18H35N5OS and a molecular weight of 369.58 g/mol. Its IUPAC name is N'-[[3-(dimethylamino)thiolan-3-yl]methyl]-N-ethyl-4-(2-methylpropanoyl)piperazine-1-carboximidamide.
| Compound Name | N'-[[3-(dimethylamino)thiolan-3-yl]methyl]-N-ethyl-4-(2-methylpropanoyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119156894 |
| Molecular Formula | C18H35N5OS |
| Molecular Weight | 369.58 g/mol |
| Exact Mass | 369.26 |
| IUPAC Name | N'-[[3-(dimethylamino)thiolan-3-yl]methyl]-N-ethyl-4-(2-methylpropanoyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1(N(C)C)CCSC1)N1CCN(C(=O)C(C)C)CC1 |
| InChI | InChI=1S/C18H35N5OS/c1-6-19-17(20-13-18(21(4)5)7-12-25-14-18)23-10-8-22(9-11-23)16(24)15(2)3/h15H,6-14H2,1-5H3,(H,19,20) |
| InChIKey | VQINNHBQBVFWOE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.58 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|