C19H32IN5O2S — CID 119156821
N'-[[3-(dimethylamino)thiolan-3-yl]methyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 119156821) has the molecular formula C19H32IN5O2S and a molecular weight of 521.47 g/mol. Its IUPAC name is N'-[[3-(dimethylamino)thiolan-3-yl]methyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[3-(dimethylamino)thiolan-3-yl]methyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119156821 |
| Molecular Formula | C19H32IN5O2S |
| Molecular Weight | 521.47 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | N'-[[3-(dimethylamino)thiolan-3-yl]methyl]-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1(N(C)C)CCSC1)N1CCN(C(=O)c2ccco2)CC1.I |
| InChI | InChI=1S/C19H31N5O2S.HI/c1-4-20-18(21-14-19(22(2)3)7-13-27-15-19)24-10-8-23(9-11-24)17(25)16-6-5-12-26-16;/h5-6,12H,4,7-11,13-15H2,1-3H3,(H,20,21);1H |
| InChIKey | SGWBFMPVJUYKHM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|