C23H37N5O3 — CID 111167353
N-ethyl-4-(furan-2-carbonyl)-N'-[(1-morpholin-4-ylcyclohexyl)methyl]piperazine-1-carboximidamide (PubChem CID 111167353) has the molecular formula C23H37N5O3 and a molecular weight of 431.58 g/mol. Its IUPAC name is N-ethyl-4-(furan-2-carbonyl)-N'-[(1-morpholin-4-ylcyclohexyl)methyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(furan-2-carbonyl)-N'-[(1-morpholin-4-ylcyclohexyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111167353 |
| Molecular Formula | C23H37N5O3 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | N-ethyl-4-(furan-2-carbonyl)-N'-[(1-morpholin-4-ylcyclohexyl)methyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1(N2CCOCC2)CCCCC1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C23H37N5O3/c1-2-24-22(27-12-10-26(11-13-27)21(29)20-7-6-16-31-20)25-19-23(8-4-3-5-9-23)28-14-17-30-18-15-28/h6-7,16H,2-5,8-15,17-19H2,1H3,(H,24,25) |
| InChIKey | UNNSHXBZXRYJPZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 73.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|