C15H29N5OS — CID 119156780
4-acetyl-N-[[3-(dimethylamino)thiolan-3-yl]methyl]-N'-methylpiperazine-1-carboximidamide (PubChem CID 119156780) has the molecular formula C15H29N5OS and a molecular weight of 327.50 g/mol. Its IUPAC name is 4-acetyl-N-[[3-(dimethylamino)thiolan-3-yl]methyl]-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-acetyl-N-[[3-(dimethylamino)thiolan-3-yl]methyl]-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119156780 |
| Molecular Formula | C15H29N5OS |
| Molecular Weight | 327.50 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 4-acetyl-N-[[3-(dimethylamino)thiolan-3-yl]methyl]-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC1(N(C)C)CCSC1)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C15H29N5OS/c1-13(21)19-6-8-20(9-7-19)14(16-2)17-11-15(18(3)4)5-10-22-12-15/h5-12H2,1-4H3,(H,16,17) |
| InChIKey | XTRQSILCLFOSIC-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.50 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|