C15H30N4S — CID 119156808
N-[[3-(dimethylamino)thiolan-3-yl]methyl]-N',3-dimethylpiperidine-1-carboximidamide (PubChem CID 119156808) has the molecular formula C15H30N4S and a molecular weight of 298.50 g/mol. Its IUPAC name is N-[[3-(dimethylamino)thiolan-3-yl]methyl]-N',3-dimethylpiperidine-1-carboximidamide.
| Compound Name | N-[[3-(dimethylamino)thiolan-3-yl]methyl]-N',3-dimethylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 119156808 |
| Molecular Formula | C15H30N4S |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | N-[[3-(dimethylamino)thiolan-3-yl]methyl]-N',3-dimethylpiperidine-1-carboximidamide |
| SMILES | C/N=C(\NCC1(N(C)C)CCSC1)N1CCCC(C)C1 |
| InChI | InChI=1S/C15H30N4S/c1-13-6-5-8-19(10-13)14(16-2)17-11-15(18(3)4)7-9-20-12-15/h13H,5-12H2,1-4H3,(H,16,17) |
| InChIKey | KSGRIGKBIRZEIB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|