C17H34N4 — CID 111143840
N-[2-[cyclohexyl(methyl)amino]ethyl]-N',3-dimethylpiperidine-1-carboximidamide (PubChem CID 111143840) has the molecular formula C17H34N4 and a molecular weight of 294.49 g/mol. Its IUPAC name is N-[2-[cyclohexyl(methyl)amino]ethyl]-N',3-dimethylpiperidine-1-carboximidamide.
| Compound Name | N-[2-[cyclohexyl(methyl)amino]ethyl]-N',3-dimethylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111143840 |
| Molecular Formula | C17H34N4 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.28 |
| IUPAC Name | N-[2-[cyclohexyl(methyl)amino]ethyl]-N',3-dimethylpiperidine-1-carboximidamide |
| SMILES | C/N=C(\NCCN(C)C1CCCCC1)N1CCCC(C)C1 |
| InChI | InChI=1S/C17H34N4/c1-15-8-7-12-21(14-15)17(18-2)19-11-13-20(3)16-9-5-4-6-10-16/h15-16H,4-14H2,1-3H3,(H,18,19) |
| InChIKey | IXTQPSCKMFTZJY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|