C15H30IN3OS — CID 111510801
N',3-dimethyl-N-[(4-methylsulfanyloxan-4-yl)methyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111510801) has the molecular formula C15H30IN3OS and a molecular weight of 427.40 g/mol. Its IUPAC name is N',3-dimethyl-N-[(4-methylsulfanyloxan-4-yl)methyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N',3-dimethyl-N-[(4-methylsulfanyloxan-4-yl)methyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111510801 |
| Molecular Formula | C15H30IN3OS |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | N',3-dimethyl-N-[(4-methylsulfanyloxan-4-yl)methyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCC1(SC)CCOCC1)N1CCCC(C)C1.I |
| InChI | InChI=1S/C15H29N3OS.HI/c1-13-5-4-8-18(11-13)14(16-2)17-12-15(20-3)6-9-19-10-7-15;/h13H,4-12H2,1-3H3,(H,16,17);1H |
| InChIKey | SDWWDVIXHDALHD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|