C18H31N5S2 — CID 119156914
N-[[3-(dimethylamino)thiolan-3-yl]methyl]-N'-methyl-4-(thiophen-2-ylmethyl)piperazine-1-carboximidamide (PubChem CID 119156914) has the molecular formula C18H31N5S2 and a molecular weight of 381.62 g/mol. Its IUPAC name is N-[[3-(dimethylamino)thiolan-3-yl]methyl]-N'-methyl-4-(thiophen-2-ylmethyl)piperazine-1-carboximidamide.
| Compound Name | N-[[3-(dimethylamino)thiolan-3-yl]methyl]-N'-methyl-4-(thiophen-2-ylmethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119156914 |
| Molecular Formula | C18H31N5S2 |
| Molecular Weight | 381.62 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | N-[[3-(dimethylamino)thiolan-3-yl]methyl]-N'-methyl-4-(thiophen-2-ylmethyl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC1(N(C)C)CCSC1)N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C18H31N5S2/c1-19-17(20-14-18(21(2)3)6-12-24-15-18)23-9-7-22(8-10-23)13-16-5-4-11-25-16/h4-5,11H,6-10,12-15H2,1-3H3,(H,19,20) |
| InChIKey | RWMOVFLEDGIFQR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.62 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|