C18H31N5O2S2 — CID 111367413
N'-methyl-N-[(1-methylsulfonylpiperidin-4-yl)methyl]-4-(thiophen-2-ylmethyl)piperazine-1-carboximidamide (PubChem CID 111367413) has the molecular formula C18H31N5O2S2 and a molecular weight of 413.61 g/mol. Its IUPAC name is N'-methyl-N-[(1-methylsulfonylpiperidin-4-yl)methyl]-4-(thiophen-2-ylmethyl)piperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[(1-methylsulfonylpiperidin-4-yl)methyl]-4-(thiophen-2-ylmethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111367413 |
| Molecular Formula | C18H31N5O2S2 |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N'-methyl-N-[(1-methylsulfonylpiperidin-4-yl)methyl]-4-(thiophen-2-ylmethyl)piperazine-1-carboximidamide |
| SMILES | C/N=C(/NCC1CCN(S(C)(=O)=O)CC1)N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C18H31N5O2S2/c1-19-18(20-14-16-5-7-23(8-6-16)27(2,24)25)22-11-9-21(10-12-22)15-17-4-3-13-26-17/h3-4,13,16H,5-12,14-15H2,1-2H3,(H,19,20) |
| InChIKey | XUCPYQFCDVMQCE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|