C24H40N4O2S — CID 109446895
N'-methyl-4-(oxan-2-ylmethoxy)-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]piperidine-1-carboximidamide (PubChem CID 109446895) has the molecular formula C24H40N4O2S and a molecular weight of 448.68 g/mol. Its IUPAC name is N'-methyl-4-(oxan-2-ylmethoxy)-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]piperidine-1-carboximidamide.
| Compound Name | N'-methyl-4-(oxan-2-ylmethoxy)-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109446895 |
| Molecular Formula | C24H40N4O2S |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 448.29 |
| IUPAC Name | N'-methyl-4-(oxan-2-ylmethoxy)-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]piperidine-1-carboximidamide |
| SMILES | C/N=C(\NCC1CCN(Cc2cccs2)CC1)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C24H40N4O2S/c1-25-24(26-17-20-7-11-27(12-8-20)18-23-6-4-16-31-23)28-13-9-21(10-14-28)30-19-22-5-2-3-15-29-22/h4,6,16,20-22H,2-3,5,7-15,17-19H2,1H3,(H,25,26) |
| InChIKey | QJVPXTNENGFUTR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|