C23H39IN4O2S — CID 109449296
N'-methyl-4-(oxan-2-ylmethoxy)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109449296) has the molecular formula C23H39IN4O2S and a molecular weight of 562.56 g/mol. Its IUPAC name is N'-methyl-4-(oxan-2-ylmethoxy)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-4-(oxan-2-ylmethoxy)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109449296 |
| Molecular Formula | C23H39IN4O2S |
| Molecular Weight | 562.56 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | N'-methyl-4-(oxan-2-ylmethoxy)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)piperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCC(c1cccs1)N1CCCC1)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C23H38N4O2S.HI/c1-24-23(25-17-21(22-8-6-16-30-22)26-11-3-4-12-26)27-13-9-19(10-14-27)29-18-20-7-2-5-15-28-20;/h6,8,16,19-21H,2-5,7,9-15,17-18H2,1H3,(H,24,25);1H |
| InChIKey | DTHQDJJWKGSPTO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|