C18H32N6OS — CID 119156926
N-[[3-(dimethylamino)thiolan-3-yl]methyl]-N'-methyl-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1-carboximidamide (PubChem CID 119156926) has the molecular formula C18H32N6OS and a molecular weight of 380.56 g/mol. Its IUPAC name is N-[[3-(dimethylamino)thiolan-3-yl]methyl]-N'-methyl-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | N-[[3-(dimethylamino)thiolan-3-yl]methyl]-N'-methyl-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119156926 |
| Molecular Formula | C18H32N6OS |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | N-[[3-(dimethylamino)thiolan-3-yl]methyl]-N'-methyl-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC1(N(C)C)CCSC1)N1CCN(Cc2cc(C)on2)CC1 |
| InChI | InChI=1S/C18H32N6OS/c1-15-11-16(21-25-15)12-23-6-8-24(9-7-23)17(19-2)20-13-18(22(3)4)5-10-26-14-18/h11H,5-10,12-14H2,1-4H3,(H,19,20) |
| InChIKey | NAQFKOJBFZGOHN-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 60.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|