C18H31N5O3 — CID 111378558
N-ethyl-N'-[(4-hydroxyoxan-4-yl)methyl]-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1-carboximidamide (PubChem CID 111378558) has the molecular formula C18H31N5O3 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-ethyl-N'-[(4-hydroxyoxan-4-yl)methyl]-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[(4-hydroxyoxan-4-yl)methyl]-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111378558 |
| Molecular Formula | C18H31N5O3 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | N-ethyl-N'-[(4-hydroxyoxan-4-yl)methyl]-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1(O)CCOCC1)N1CCN(Cc2cc(C)on2)CC1 |
| InChI | InChI=1S/C18H31N5O3/c1-3-19-17(20-14-18(24)4-10-25-11-5-18)23-8-6-22(7-9-23)13-16-12-15(2)26-21-16/h12,24H,3-11,13-14H2,1-2H3,(H,19,20) |
| InChIKey | UBRQODLJKOYTEN-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|