C21H31FIN5O3 — CID 111378427
N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111378427) has the molecular formula C21H31FIN5O3 and a molecular weight of 547.41 g/mol. Its IUPAC name is N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111378427 |
| Molecular Formula | C21H31FIN5O3 |
| Molecular Weight | 547.41 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(O)COc1ccc(F)cc1)N1CCN(Cc2cc(C)on2)CC1.I |
| InChI | InChI=1S/C21H30FN5O3.HI/c1-3-23-21(24-13-19(28)15-29-20-6-4-17(22)5-7-20)27-10-8-26(9-11-27)14-18-12-16(2)30-25-18;/h4-7,12,19,28H,3,8-11,13-15H2,1-2H3,(H,23,24);1H |
| InChIKey | FSLOTLIHEHIBEN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|