C21H31N5OS — CID 111496222
N-ethyl-4-[(5-methyl-1,2-oxazol-3-yl)methyl]-N'-(2-phenylsulfanylpropyl)piperazine-1-carboximidamide (PubChem CID 111496222) has the molecular formula C21H31N5OS and a molecular weight of 401.58 g/mol. Its IUPAC name is N-ethyl-4-[(5-methyl-1,2-oxazol-3-yl)methyl]-N'-(2-phenylsulfanylpropyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-[(5-methyl-1,2-oxazol-3-yl)methyl]-N'-(2-phenylsulfanylpropyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111496222 |
| Molecular Formula | C21H31N5OS |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | N-ethyl-4-[(5-methyl-1,2-oxazol-3-yl)methyl]-N'-(2-phenylsulfanylpropyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(C)Sc1ccccc1)N1CCN(Cc2cc(C)on2)CC1 |
| InChI | InChI=1S/C21H31N5OS/c1-4-22-21(23-15-18(3)28-20-8-6-5-7-9-20)26-12-10-25(11-13-26)16-19-14-17(2)27-24-19/h5-9,14,18H,4,10-13,15-16H2,1-3H3,(H,22,23) |
| InChIKey | BCTBHPNMUMNHEQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 56.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|